About CID 167621861
CID 167621861 (PubChem CID 167621861) has the molecular formula C14H20BN2
and a molecular weight of 227.14 g/mol.
Molecular Properties
| Compound Name | CID 167621861 |
| PubChem CID | 167621861 |
| Molecular Formula | C14H20BN2 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(C#N)c(C(C)(C)C)n1.[B] |
| InChI | InChI=1S/C14H20N2.B/c1-13(2,3)11-8-7-10(9-15)12(16-11)14(4,5)6;/h7-8H,1-6H3; |
| InChIKey | FTBKHLVINKUQPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167621861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167621861?
The IUPAC name of CID 167621861 (CID 167621861) is not available.
What is the SMILES notation for CID 167621861?
The canonical SMILES for CID 167621861 is CC(C)(C)c1ccc(C#N)c(C(C)(C)C)n1.[B].
What is the InChIKey of CID 167621861?
The InChIKey is FTBKHLVINKUQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2.B/c1-13(2,3)11-8-7-10(9-15)12(16-11)14(4,5)6;/h7-8H,1-6H3;.
What are the key properties of CID 167621861?
CID 167621861 has a molecular weight of 227.14 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167621861 is sourced from PubChem (CID 167621861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).