C13H20N2O2 — CID 177282858
2,6-ditert-butyl-3-nitropyridine (PubChem CID 177282858) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,6-ditert-butyl-3-nitropyridine.
| Compound Name | 2,6-ditert-butyl-3-nitropyridine |
|---|---|
| PubChem CID | 177282858 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2,6-ditert-butyl-3-nitropyridine |
| SMILES | CC(C)(C)c1ccc([N+](=O)[O-])c(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H20N2O2/c1-12(2,3)10-8-7-9(15(16)17)11(14-10)13(4,5)6/h7-8H,1-6H3 |
| InChIKey | BHOQNVNFKLWBJO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|