C18H23NO2 — CID 640604
3,6-ditert-butyl-1-nitronaphthalene (PubChem CID 640604) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-nitronaphthalene.
| Compound Name | 3,6-ditert-butyl-1-nitronaphthalene |
|---|---|
| PubChem CID | 640604 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3,6-ditert-butyl-1-nitronaphthalene |
| SMILES | CC(C)(C)c1ccc2c([N+](=O)[O-])cc(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C18H23NO2/c1-17(2,3)13-7-8-15-12(9-13)10-14(18(4,5)6)11-16(15)19(20)21/h7-11H,1-6H3 |
| InChIKey | LELLFQUXOMFKNV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|