C19H24N2O2 — CID 121252343
6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide (PubChem CID 121252343) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121252343 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C(N)=O)c(C)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-11-9-12(2)16(13(3)10-11)23-18-14(17(20)22)7-8-15(21-18)19(4,5)6/h7-10H,1-6H3,(H2,20,22) |
| InChIKey | JRVIZLFPDYXIRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |