C24H25FN4O4S — CID 172827750
6-tert-butyl-N-[(6-fluoro-2-pyridinyl)sulfonylimino]-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide (PubChem CID 172827750) has the molecular formula C24H25FN4O4S and a molecular weight of 484.55 g/mol. Its IUPAC name is 6-tert-butyl-N-[(6-fluoro-2-pyridinyl)sulfonylimino]-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide.
| Compound Name | 6-tert-butyl-N-[(6-fluoro-2-pyridinyl)sulfonylimino]-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172827750 |
| Molecular Formula | C24H25FN4O4S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 6-tert-butyl-N-[(6-fluoro-2-pyridinyl)sulfonylimino]-2-(2,4,6-trimethylphenoxy)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C(=O)/N=N/S(=O)(=O)c2cccc(F)n2)c(C)c1 |
| InChI | InChI=1S/C24H25FN4O4S/c1-14-12-15(2)21(16(3)13-14)33-23-17(10-11-18(26-23)24(4,5)6)22(30)28-29-34(31,32)20-9-7-8-19(25)27-20/h7-13H,1-6H3/b29-28+ |
| InChIKey | VCHFBGKAKRAHMI-ZQHSETAFSA-N |
| XLogP | 5.61 |
| TPSA | 110.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|