C24H29N5O3S — CID 175070572
(6-amino-2-pyridinyl)-[2-[6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonyl]hydrazinyl]-oxidosulfanium (PubChem CID 175070572) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-[2-[6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonyl]hydrazinyl]-oxidosulfanium.
| Compound Name | (6-amino-2-pyridinyl)-[2-[6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonyl]hydrazinyl]-oxidosulfanium |
|---|---|
| PubChem CID | 175070572 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (6-amino-2-pyridinyl)-[2-[6-tert-butyl-2-(2,4,6-trimethylphenoxy)pyridine-3-carbonyl]hydrazinyl]-oxidosulfanium |
| SMILES | Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C(=O)NN[S+]([O-])c2cccc(N)n2)c(C)c1 |
| InChI | InChI=1S/C24H29N5O3S/c1-14-12-15(2)21(16(3)13-14)32-23-17(10-11-18(26-23)24(4,5)6)22(30)28-29-33(31)20-9-7-8-19(25)27-20/h7-13,29H,1-6H3,(H2,25,27)(H,28,30) |
| InChIKey | DBSQQWPIGPVNFQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|