C25H29F2N3O4S — CID 131989940
N-[[6-tert-butyl-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]-hydroxymethyl]-6-(difluoromethyl)pyridine-2-sulfonamide (PubChem CID 131989940) has the molecular formula C25H29F2N3O4S and a molecular weight of 505.59 g/mol. Its IUPAC name is N-[[6-tert-butyl-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]-hydroxymethyl]-6-(difluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-[[6-tert-butyl-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]-hydroxymethyl]-6-(difluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 131989940 |
| Molecular Formula | C25H29F2N3O4S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-[[6-tert-butyl-2-(2,4,6-trimethylphenoxy)-3-pyridinyl]-hydroxymethyl]-6-(difluoromethyl)pyridine-2-sulfonamide |
| SMILES | Cc1cc(C)c(Oc2nc(C(C)(C)C)ccc2C(O)NS(=O)(=O)c2cccc(C(F)F)n2)c(C)c1 |
| InChI | InChI=1S/C25H29F2N3O4S/c1-14-12-15(2)21(16(3)13-14)34-24-17(10-11-19(29-24)25(4,5)6)23(31)30-35(32,33)20-9-7-8-18(28-20)22(26)27/h7-13,22-23,30-31H,1-6H3 |
| InChIKey | GDNUZGHYPIOZJI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|