About 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile
6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile (PubChem CID 121250670) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile |
| PubChem CID | 121250670 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile |
| SMILES | Cc1cc(C)c(Cc2ccc(C(C)(C)C)nc2C#N)c(C)c1 |
| InChI | InChI=1S/C20H24N2/c1-13-9-14(2)17(15(3)10-13)11-16-7-8-19(20(4,5)6)22-18(16)12-21/h7-10H,11H2,1-6H3 |
| InChIKey | SCHNDJDKXGCIRN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile?
The IUPAC name of 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile (CID 121250670) is 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile?
The canonical SMILES for 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile is Cc1cc(C)c(Cc2ccc(C(C)(C)C)nc2C#N)c(C)c1.
What is the InChIKey of 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile?
The InChIKey is SCHNDJDKXGCIRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2/c1-13-9-14(2)17(15(3)10-13)11-16-7-8-19(20(4,5)6)22-18(16)12-21/h7-10H,11H2,1-6H3.
What are the key properties of 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile?
6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile has a molecular weight of 292.43 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3-[(2,4,6-trimethylphenyl)methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 121250670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).