C16H21NS — CID 82448688
(2-tert-butyl-5,7-dimethylquinolin-4-yl)methanethiol (PubChem CID 82448688) has the molecular formula C16H21NS and a molecular weight of 259.42 g/mol. Its IUPAC name is (2-tert-butyl-5,7-dimethylquinolin-4-yl)methanethiol.
| Compound Name | (2-tert-butyl-5,7-dimethylquinolin-4-yl)methanethiol |
|---|---|
| PubChem CID | 82448688 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2-tert-butyl-5,7-dimethylquinolin-4-yl)methanethiol |
| SMILES | Cc1cc(C)c2c(CS)cc(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C16H21NS/c1-10-6-11(2)15-12(9-18)8-14(16(3,4)5)17-13(15)7-10/h6-8,18H,9H2,1-5H3 |
| InChIKey | VQYQGOMNOHCDGZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|