C18H22F3N — CID 162414301
5,7-dimethyl-3,4-dipropyl-2-(trifluoromethyl)quinoline (PubChem CID 162414301) has the molecular formula C18H22F3N and a molecular weight of 309.38 g/mol. Its IUPAC name is 5,7-dimethyl-3,4-dipropyl-2-(trifluoromethyl)quinoline.
| Compound Name | 5,7-dimethyl-3,4-dipropyl-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 162414301 |
| Molecular Formula | C18H22F3N |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 5,7-dimethyl-3,4-dipropyl-2-(trifluoromethyl)quinoline |
| SMILES | CCCc1c(C(F)(F)F)nc2cc(C)cc(C)c2c1CCC |
| InChI | InChI=1S/C18H22F3N/c1-5-7-13-14(8-6-2)17(18(19,20)21)22-15-10-11(3)9-12(4)16(13)15/h9-10H,5-8H2,1-4H3 |
| InChIKey | BYPATXVXPQCWSV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |