C23H27FN2O6S2 — CID 175175281
1-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]ethylsulfonyl 3-(methylsulfamoyl)benzoate (PubChem CID 175175281) has the molecular formula C23H27FN2O6S2 and a molecular weight of 510.61 g/mol. Its IUPAC name is 1-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]ethylsulfonyl 3-(methylsulfamoyl)benzoate.
| Compound Name | 1-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]ethylsulfonyl 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 175175281 |
| Molecular Formula | C23H27FN2O6S2 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 1-[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]ethylsulfonyl 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OS(=O)(=O)C(C)c2c(C(C)C)cc(C#N)c(F)c2C(C)C)c1 |
| InChI | InChI=1S/C23H27FN2O6S2/c1-13(2)19-11-17(12-25)22(24)20(14(3)4)21(19)15(5)34(30,31)32-23(27)16-8-7-9-18(10-16)33(28,29)26-6/h7-11,13-15,26H,1-6H3 |
| InChIKey | AXFGPDCFEVKGOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|