C22H34O2 — CID 146570919
2-[4-(2-cyclohexylethyl)-2,6-di(propan-2-yl)phenyl]acetic acid (PubChem CID 146570919) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-[4-(2-cyclohexylethyl)-2,6-di(propan-2-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(2-cyclohexylethyl)-2,6-di(propan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 146570919 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 2-[4-(2-cyclohexylethyl)-2,6-di(propan-2-yl)phenyl]acetic acid |
| SMILES | CC(C)c1cc(CCC2CCCCC2)cc(C(C)C)c1CC(=O)O |
| InChI | InChI=1S/C22H34O2/c1-15(2)19-12-18(11-10-17-8-6-5-7-9-17)13-20(16(3)4)21(19)14-22(23)24/h12-13,15-17H,5-11,14H2,1-4H3,(H,23,24) |
| InChIKey | UWOBGAQQYVCLAC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |