C15H22S — CID 170478813
4-(2,6-diethyl-4-methylphenyl)but-3-ene-1-thiol (PubChem CID 170478813) has the molecular formula C15H22S and a molecular weight of 234.41 g/mol. Its IUPAC name is 4-(2,6-diethyl-4-methylphenyl)but-3-ene-1-thiol.
| Compound Name | 4-(2,6-diethyl-4-methylphenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478813 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(2,6-diethyl-4-methylphenyl)but-3-ene-1-thiol |
| SMILES | CCc1cc(C)cc(CC)c1C=CCCS |
| InChI | InChI=1S/C15H22S/c1-4-13-10-12(3)11-14(5-2)15(13)8-6-7-9-16/h6,8,10-11,16H,4-5,7,9H2,1-3H3 |
| InChIKey | PDJBFDSSUVOUEB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|