C12H16OS — CID 170478236
[2-methyl-5-(4-sulfanylbut-1-enyl)phenyl]methanol (PubChem CID 170478236) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is [2-methyl-5-(4-sulfanylbut-1-enyl)phenyl]methanol.
| Compound Name | [2-methyl-5-(4-sulfanylbut-1-enyl)phenyl]methanol |
|---|---|
| PubChem CID | 170478236 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | [2-methyl-5-(4-sulfanylbut-1-enyl)phenyl]methanol |
| SMILES | Cc1ccc(C=CCCS)cc1CO |
| InChI | InChI=1S/C12H16OS/c1-10-5-6-11(4-2-3-7-14)8-12(10)9-13/h2,4-6,8,13-14H,3,7,9H2,1H3 |
| InChIKey | RNEMDWGCADPLTO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|