C10H7F5S — CID 170478812
4-(2,3,4,5,6-pentafluorophenyl)but-3-ene-1-thiol (PubChem CID 170478812) has the molecular formula C10H7F5S and a molecular weight of 254.22 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)but-3-ene-1-thiol.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478812 |
| Molecular Formula | C10H7F5S |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)but-3-ene-1-thiol |
| SMILES | Fc1c(F)c(F)c(C=CCCS)c(F)c1F |
| InChI | InChI=1S/C10H7F5S/c11-6-5(3-1-2-4-16)7(12)9(14)10(15)8(6)13/h1,3,16H,2,4H2 |
| InChIKey | LXVMYPARJXZYIN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|