C11H7ClF4O2 — CID 170500045
4-(4-chlorobut-1-enyl)-2,3,5,6-tetrafluorobenzoic acid (PubChem CID 170500045) has the molecular formula C11H7ClF4O2 and a molecular weight of 282.62 g/mol. Its IUPAC name is 4-(4-chlorobut-1-enyl)-2,3,5,6-tetrafluorobenzoic acid.
| Compound Name | 4-(4-chlorobut-1-enyl)-2,3,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 170500045 |
| Molecular Formula | C11H7ClF4O2 |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 4-(4-chlorobut-1-enyl)-2,3,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(C=CCCCl)c(F)c1F |
| InChI | InChI=1S/C11H7ClF4O2/c12-4-2-1-3-5-7(13)9(15)6(11(17)18)10(16)8(5)14/h1,3H,2,4H2,(H,17,18) |
| InChIKey | PBFAIHDIWOPBNW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|