About [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium
[(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium (PubChem CID 122375441) has the molecular formula C20H32I+
and a molecular weight of 399.38 g/mol. Its IUPAC name is [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium.
Molecular Properties
| Compound Name | [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium |
| PubChem CID | 122375441 |
| Molecular Formula | C20H32I+ |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium |
| SMILES | CCC/C=C/[I+]c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C20H32I/c1-8-9-10-11-21-20-18(15(4)5)12-17(14(2)3)13-19(20)16(6)7/h10-16H,8-9H2,1-7H3/q+1/b11-10+ |
| InChIKey | DJMFMIOLSYNKRT-ZHACJKMWSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium?
The IUPAC name of [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium (CID 122375441) is [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium.
What is the SMILES notation for [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium?
The canonical SMILES for [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium is CCC/C=C/[I+]c1c(C(C)C)cc(C(C)C)cc1C(C)C.
What is the InChIKey of [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium?
The InChIKey is DJMFMIOLSYNKRT-ZHACJKMWSA-N. The full InChI is InChI=1S/C20H32I/c1-8-9-10-11-21-20-18(15(4)5)12-17(14(2)3)13-19(20)16(6)7/h10-16H,8-9H2,1-7H3/q+1/b11-10+.
What are the key properties of [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium?
[(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium has a molecular weight of 399.38 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-pent-1-enyl]-[2,4,6-tri(propan-2-yl)phenyl]iodanium is sourced from PubChem (CID 122375441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).