C36H52O4S — CID 118298822
2,5-bis[2,6-di(propan-2-yl)phenyl]-3,4-bis(2-methoxyethoxymethyl)thiophene (PubChem CID 118298822) has the molecular formula C36H52O4S and a molecular weight of 580.88 g/mol. Its IUPAC name is 2,5-bis[2,6-di(propan-2-yl)phenyl]-3,4-bis(2-methoxyethoxymethyl)thiophene.
| Compound Name | 2,5-bis[2,6-di(propan-2-yl)phenyl]-3,4-bis(2-methoxyethoxymethyl)thiophene |
|---|---|
| PubChem CID | 118298822 |
| Molecular Formula | C36H52O4S |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | 2,5-bis[2,6-di(propan-2-yl)phenyl]-3,4-bis(2-methoxyethoxymethyl)thiophene |
| SMILES | COCCOCc1c(-c2c(C(C)C)cccc2C(C)C)sc(-c2c(C(C)C)cccc2C(C)C)c1COCCOC |
| InChI | InChI=1S/C36H52O4S/c1-23(2)27-13-11-14-28(24(3)4)33(27)35-31(21-39-19-17-37-9)32(22-40-20-18-38-10)36(41-35)34-29(25(5)6)15-12-16-30(34)26(7)8/h11-16,23-26H,17-22H2,1-10H3 |
| InChIKey | OAQLTAZUKJXHPG-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|