C28H36O4S — CID 118298810
2,5-bis(2,6-dimethylphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene (PubChem CID 118298810) has the molecular formula C28H36O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is 2,5-bis(2,6-dimethylphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene.
| Compound Name | 2,5-bis(2,6-dimethylphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene |
|---|---|
| PubChem CID | 118298810 |
| Molecular Formula | C28H36O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2,5-bis(2,6-dimethylphenyl)-3,4-bis(2-methoxyethoxymethyl)thiophene |
| SMILES | COCCOCc1c(-c2c(C)cccc2C)sc(-c2c(C)cccc2C)c1COCCOC |
| InChI | InChI=1S/C28H36O4S/c1-19-9-7-10-20(2)25(19)27-23(17-31-15-13-29-5)24(18-32-16-14-30-6)28(33-27)26-21(3)11-8-12-22(26)4/h7-12H,13-18H2,1-6H3 |
| InChIKey | QKYNHGSOXBQRFJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|