C14H18FNO2S — CID 62457697
1-[4-fluoro-3-(2-methoxyethoxymethyl)-1-benzothiophen-2-yl]-N-methylmethanamine (PubChem CID 62457697) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[4-fluoro-3-(2-methoxyethoxymethyl)-1-benzothiophen-2-yl]-N-methylmethanamine.
| Compound Name | 1-[4-fluoro-3-(2-methoxyethoxymethyl)-1-benzothiophen-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62457697 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-[4-fluoro-3-(2-methoxyethoxymethyl)-1-benzothiophen-2-yl]-N-methylmethanamine |
| SMILES | CNCc1sc2cccc(F)c2c1COCCOC |
| InChI | InChI=1S/C14H18FNO2S/c1-16-8-13-10(9-18-7-6-17-2)14-11(15)4-3-5-12(14)19-13/h3-5,16H,6-9H2,1-2H3 |
| InChIKey | OHXWPOSDEPBNGW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|