C16H22FNO2S — CID 115942816
[4-fluoro-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]-1-benzothiophen-2-yl]methanamine (PubChem CID 115942816) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is [4-fluoro-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]-1-benzothiophen-2-yl]methanamine.
| Compound Name | [4-fluoro-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]-1-benzothiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 115942816 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [4-fluoro-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]-1-benzothiophen-2-yl]methanamine |
| SMILES | CC(C)(C)OCCOCc1c(CN)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H22FNO2S/c1-16(2,3)20-8-7-19-10-11-14(9-18)21-13-6-4-5-12(17)15(11)13/h4-6H,7-10,18H2,1-3H3 |
| InChIKey | SXFBAIUNRBYSMC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|