C67H80OS2 — CID 177494145
1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-[(hydroxydisulfanyl)methyl]benzene (PubChem CID 177494145) has the molecular formula C67H80OS2 and a molecular weight of 965.51 g/mol. Its IUPAC name is 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-[(hydroxydisulfanyl)methyl]benzene.
| Compound Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-[(hydroxydisulfanyl)methyl]benzene |
|---|---|
| PubChem CID | 177494145 |
| Molecular Formula | C67H80OS2 |
| Molecular Weight | 965.51 g/mol |
| Exact Mass | 964.57 |
| IUPAC Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-[(hydroxydisulfanyl)methyl]benzene |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(-c2cccc(-c3cc(-c4c(C(C)C)cccc4C(C)C)cc(-c4c(C(C)C)cccc4C(C)C)c3)c2CSSO)cc(-c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C67H80OS2/c1-39(2)53-22-17-23-54(40(3)4)64(53)49-32-47(33-50(36-49)65-55(41(5)6)24-18-25-56(65)42(7)8)61-30-21-31-62(63(61)38-69-70-68)48-34-51(66-57(43(9)10)26-19-27-58(66)44(11)12)37-52(35-48)67-59(45(13)14)28-20-29-60(67)46(15)16/h17-37,39-46,68H,38H2,1-16H3 |
| InChIKey | IWBBTZMQBVMTPB-UHFFFAOYSA-N |
| XLogP | 22.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.51 |
| LogP ≤ 5 | 22.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|