C22H33N3O2S — CID 164949578
N-[amino-[4-(dimethylamino)cyclohexyl]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide (PubChem CID 164949578) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-[amino-[4-(dimethylamino)cyclohexyl]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide.
| Compound Name | N-[amino-[4-(dimethylamino)cyclohexyl]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
|---|---|
| PubChem CID | 164949578 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[amino-[4-(dimethylamino)cyclohexyl]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
| SMILES | CN(C)C1CCC(S(N)(=O)=NC(=O)Cc2c3c(cc4c2CCC4)CCC3)CC1 |
| InChI | InChI=1S/C22H33N3O2S/c1-25(2)17-9-11-18(12-10-17)28(23,27)24-22(26)14-21-19-7-3-5-15(19)13-16-6-4-8-20(16)21/h13,17-18H,3-12,14H2,1-2H3,(H2,23,24,26,27) |
| InChIKey | AIMGLEKJINIOJV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |