C24H36N6O2S — CID 155396528
N-[amino-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-(1-methylpiperidin-3-yl)amino]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide (PubChem CID 155396528) has the molecular formula C24H36N6O2S and a molecular weight of 472.66 g/mol. Its IUPAC name is N-[amino-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-(1-methylpiperidin-3-yl)amino]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide.
| Compound Name | N-[amino-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-(1-methylpiperidin-3-yl)amino]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
|---|---|
| PubChem CID | 155396528 |
| Molecular Formula | C24H36N6O2S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[amino-[[(E)-1-amino-3-methyliminoprop-1-en-2-yl]-(1-methylpiperidin-3-yl)amino]-oxo-λ6-sulfanylidene]-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetamide |
| SMILES | C/N=C/C(=C\N)N(C1CCCN(C)C1)S(N)(=O)=NC(=O)Cc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C24H36N6O2S/c1-27-15-20(14-25)30(19-8-5-11-29(2)16-19)33(26,32)28-24(31)13-23-21-9-3-6-17(21)12-18-7-4-10-22(18)23/h12,14-15,19H,3-11,13,16,25H2,1-2H3,(H2,26,28,31,32)/b20-14+,27-15+ |
| InChIKey | NQDDWCHQXXXXIY-FJPFKKOMSA-N |
| XLogP | 1.89 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|