C20H29KN3O3S — CID 175947001
CID 175947001 (PubChem CID 175947001) has the molecular formula C20H29KN3O3S and a molecular weight of 430.64 g/mol.
| Compound Name | CID 175947001 |
|---|---|
| PubChem CID | 175947001 |
| Molecular Formula | C20H29KN3O3S |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | — |
| SMILES | CN1CCC(CS(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1.[K] |
| InChI | InChI=1S/C20H29N3O3S.K/c1-23-10-8-14(9-11-23)13-27(25,26)22-20(24)21-19-17-6-2-4-15(17)12-16-5-3-7-18(16)19;/h12,14H,2-11,13H2,1H3,(H2,21,22,24); |
| InChIKey | VLJWWWXVJHJNBC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |