C19H27KN3O3S — CID 175724048
CID 175724048 (PubChem CID 175724048) has the molecular formula C19H27KN3O3S and a molecular weight of 416.61 g/mol.
| Compound Name | CID 175724048 |
|---|---|
| PubChem CID | 175724048 |
| Molecular Formula | C19H27KN3O3S |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | — |
| SMILES | CCN1CCC(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)C1.[K] |
| InChI | InChI=1S/C19H27N3O3S.K/c1-2-22-10-9-15(12-22)26(24,25)21-19(23)20-18-16-7-3-5-13(16)11-14-6-4-8-17(14)18;/h11,15H,2-10,12H2,1H3,(H2,20,21,23); |
| InChIKey | ZWMXSPZPXLAFFV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |