C20H24F3KN3O4S — CID 175724131
CID 175724131 (PubChem CID 175724131) has the molecular formula C20H24F3KN3O4S and a molecular weight of 498.59 g/mol.
| Compound Name | CID 175724131 |
|---|---|
| PubChem CID | 175724131 |
| Molecular Formula | C20H24F3KN3O4S |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | — |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)C1CCN(C(=O)C(F)(F)F)CC1.[K] |
| InChI | InChI=1S/C20H24F3N3O4S.K/c21-20(22,23)18(27)26-9-7-14(8-10-26)31(29,30)25-19(28)24-17-15-5-1-3-12(15)11-13-4-2-6-16(13)17;/h11,14H,1-10H2,(H2,24,25,28); |
| InChIKey | HXPZDGLGRFBPCA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |