C18H20F3N3O4S — CID 137402992
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-yl]sulfonylurea (PubChem CID 137402992) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-yl]sulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-yl]sulfonylurea |
|---|---|
| PubChem CID | 137402992 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[2-oxo-1-(2,2,2-trifluoroethyl)azetidin-3-yl]sulfonylurea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)C1CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C18H20F3N3O4S/c19-18(20,21)9-24-8-14(16(24)25)29(27,28)23-17(26)22-15-12-5-1-3-10(12)7-11-4-2-6-13(11)15/h7,14H,1-6,8-9H2,(H2,22,23,26) |
| InChIKey | QNTLTACSLWZFOD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |