C19H26F3N3O3S — CID 142529644
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(3,3,3-trifluoropropylamino)propylsulfonyl]urea (PubChem CID 142529644) has the molecular formula C19H26F3N3O3S and a molecular weight of 433.50 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(3,3,3-trifluoropropylamino)propylsulfonyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(3,3,3-trifluoropropylamino)propylsulfonyl]urea |
|---|---|
| PubChem CID | 142529644 |
| Molecular Formula | C19H26F3N3O3S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[3-(3,3,3-trifluoropropylamino)propylsulfonyl]urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)CCCNCCC(F)(F)F |
| InChI | InChI=1S/C19H26F3N3O3S/c20-19(21,22)8-10-23-9-3-11-29(27,28)25-18(26)24-17-15-6-1-4-13(15)12-14-5-2-7-16(14)17/h12,23H,1-11H2,(H2,24,25,26) |
| InChIKey | YQZDDVZLSCGKIT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|