C17H25N3O4S — CID 146394304
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-hydroxybutylsulfamoyl)urea (PubChem CID 146394304) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-hydroxybutylsulfamoyl)urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-hydroxybutylsulfamoyl)urea |
|---|---|
| PubChem CID | 146394304 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(4-hydroxybutylsulfamoyl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)NCCCCO |
| InChI | InChI=1S/C17H25N3O4S/c21-10-2-1-9-18-25(23,24)20-17(22)19-16-14-7-3-5-12(14)11-13-6-4-8-15(13)16/h11,18,21H,1-10H2,(H2,19,20,22) |
| InChIKey | AEDIYHKKKOEALS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|