C23H42N6O3S — CID 165103016
1-[2-(dimethylamino)propylsulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 165103016) has the molecular formula C23H42N6O3S and a molecular weight of 482.70 g/mol. Its IUPAC name is 1-[2-(dimethylamino)propylsulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 1-[2-(dimethylamino)propylsulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 165103016 |
| Molecular Formula | C23H42N6O3S |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 1-[2-(dimethylamino)propylsulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;2-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | CC(CN)N(C)C.CC(CNS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2)N(C)C |
| InChI | InChI=1S/C18H28N4O3S.C5H14N2/c1-12(22(2)3)11-19-26(24,25)21-18(23)20-17-15-8-4-6-13(15)10-14-7-5-9-16(14)17;1-5(4-6)7(2)3/h10,12,19H,4-9,11H2,1-3H3,(H2,20,21,23);5H,4,6H2,1-3H3 |
| InChIKey | YQQJNXMVKZHHEL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |