C23H35N5O3S — CID 164793573
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)methylsulfamoyl]urea (PubChem CID 164793573) has the molecular formula C23H35N5O3S and a molecular weight of 461.63 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)methylsulfamoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)methylsulfamoyl]urea |
|---|---|
| PubChem CID | 164793573 |
| Molecular Formula | C23H35N5O3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)methylsulfamoyl]urea |
| SMILES | CC(C)N1CC2CCC(C1)N2CNS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C23H35N5O3S/c1-15(2)27-12-18-9-10-19(13-27)28(18)14-24-32(30,31)26-23(29)25-22-20-7-3-5-16(20)11-17-6-4-8-21(17)22/h11,15,18-19,24H,3-10,12-14H2,1-2H3,(H2,25,26,29) |
| InChIKey | LNZAIKFIODSRAF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |