C24H34N4O3S — CID 155120766
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(5S)-8-(1-methylazetidin-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]sulfonyl]urea (PubChem CID 155120766) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(5S)-8-(1-methylazetidin-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]sulfonyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(5S)-8-(1-methylazetidin-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]sulfonyl]urea |
|---|---|
| PubChem CID | 155120766 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(5S)-8-(1-methylazetidin-3-yl)-8-azabicyclo[3.2.1]octan-3-yl]sulfonyl]urea |
| SMILES | CN1CC(N2C3CC[C@H]2CC(S(=O)(=O)NC(=O)Nc2c4c(cc5c2CCC5)CCC4)C3)C1 |
| InChI | InChI=1S/C24H34N4O3S/c1-27-13-19(14-27)28-17-8-9-18(28)12-20(11-17)32(30,31)26-24(29)25-23-21-6-2-4-15(21)10-16-5-3-7-22(16)23/h10,17-20H,2-9,11-14H2,1H3,(H2,25,26,29)/t17-,18?,20?/m0/s1 |
| InChIKey | CKEUWSOBCNYPAC-ZJRDLVKKSA-N |
| XLogP | 2.42 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |