C19H26KN4O3S — CID 175744007
CID 175744007 (PubChem CID 175744007) has the molecular formula C19H26KN4O3S and a molecular weight of 429.61 g/mol.
| Compound Name | CID 175744007 |
|---|---|
| PubChem CID | 175744007 |
| Molecular Formula | C19H26KN4O3S |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H]2C[C@H]1CN2S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[K] |
| InChI | InChI=1S/C19H26N4O3S.K/c1-22-10-15-9-14(22)11-23(15)27(25,26)21-19(24)20-18-16-6-2-4-12(16)8-13-5-3-7-17(13)18;/h8,14-15H,2-7,9-11H2,1H3,(H2,20,21,24);/t14-,15-;/m0./s1 |
| InChIKey | MXQDHQXSLCWTEQ-YYLIZZNMSA-N |
| XLogP | 1.04 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |