C17H24KN2O4S — CID 175947056
CID 175947056 (PubChem CID 175947056) has the molecular formula C17H24KN2O4S and a molecular weight of 391.55 g/mol.
| Compound Name | CID 175947056 |
|---|---|
| PubChem CID | 175947056 |
| Molecular Formula | C17H24KN2O4S |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | — |
| SMILES | COCCCS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[K] |
| InChI | InChI=1S/C17H24N2O4S.K/c1-23-9-4-10-24(21,22)19-17(20)18-16-14-7-2-5-12(14)11-13-6-3-8-15(13)16;/h11H,2-10H2,1H3,(H2,18,19,20); |
| InChIKey | RCWBUVXEFSVFHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|