C24H30N2O3S — CID 158385340
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(5-phenylpentylsulfonyl)urea (PubChem CID 158385340) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(5-phenylpentylsulfonyl)urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(5-phenylpentylsulfonyl)urea |
|---|---|
| PubChem CID | 158385340 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(5-phenylpentylsulfonyl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O3S/c27-24(25-23-21-14-7-12-19(21)17-20-13-8-15-22(20)23)26-30(28,29)16-6-2-5-11-18-9-3-1-4-10-18/h1,3-4,9-10,17H,2,5-8,11-16H2,(H2,25,26,27) |
| InChIKey | YYQSYEXVMPNLCX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|