C27H35N3O3S — CID 154996662
1-[2-(1-benzylpiperidin-4-yl)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 154996662) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is 1-[2-(1-benzylpiperidin-4-yl)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[2-(1-benzylpiperidin-4-yl)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 154996662 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 1-[2-(1-benzylpiperidin-4-yl)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)CCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H35N3O3S/c31-27(28-26-24-10-4-8-22(24)18-23-9-5-11-25(23)26)29-34(32,33)17-14-20-12-15-30(16-13-20)19-21-6-2-1-3-7-21/h1-3,6-7,18,20H,4-5,8-17,19H2,(H2,28,29,31) |
| InChIKey | MYYXAWGLJWHGSE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |