C19H27KN3O4S — CID 175724043
CID 175724043 (PubChem CID 175724043) has the molecular formula C19H27KN3O4S and a molecular weight of 432.61 g/mol.
| Compound Name | CID 175724043 |
|---|---|
| PubChem CID | 175724043 |
| Molecular Formula | C19H27KN3O4S |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | — |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)C1CN(CCCO)C1.[K] |
| InChI | InChI=1S/C19H27N3O4S.K/c23-9-3-8-22-11-15(12-22)27(25,26)21-19(24)20-18-16-6-1-4-13(16)10-14-5-2-7-17(14)18;/h10,15,23H,1-9,11-12H2,(H2,20,21,24); |
| InChIKey | RNYZXXIQTZASTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |