C20H28N4O4S — CID 142587949
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[1-(3-hydroxypropyl)-2-methyl-3H-pyrazol-3-yl]sulfonyl]urea (PubChem CID 142587949) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[1-(3-hydroxypropyl)-2-methyl-3H-pyrazol-3-yl]sulfonyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[1-(3-hydroxypropyl)-2-methyl-3H-pyrazol-3-yl]sulfonyl]urea |
|---|---|
| PubChem CID | 142587949 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[1-(3-hydroxypropyl)-2-methyl-3H-pyrazol-3-yl]sulfonyl]urea |
| SMILES | CN1C(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)C=CN1CCCO |
| InChI | InChI=1S/C20H28N4O4S/c1-23-18(9-11-24(23)10-4-12-25)29(27,28)22-20(26)21-19-16-7-2-5-14(16)13-15-6-3-8-17(15)19/h9,11,13,18,25H,2-8,10,12H2,1H3,(H2,21,22,26) |
| InChIKey | QFJLGTJASLQNRG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |