C20H28KN3O4S — CID 155658635
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(4-hydroxybutyl)azetidin-3-yl]sulfonylazanide (PubChem CID 155658635) has the molecular formula C20H28KN3O4S and a molecular weight of 445.63 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(4-hydroxybutyl)azetidin-3-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(4-hydroxybutyl)azetidin-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658635 |
| Molecular Formula | C20H28KN3O4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(4-hydroxybutyl)azetidin-3-yl]sulfonylazanide |
| SMILES | O=C([N-]S(=O)(=O)C1CN(CCCCO)C1)Nc1c2c(cc3c1CCC3)CCC2.[K+] |
| InChI | InChI=1S/C20H29N3O4S.K/c24-10-2-1-9-23-12-16(13-23)28(26,27)22-20(25)21-19-17-7-3-5-14(17)11-15-6-4-8-18(15)19;/h11,16,24H,1-10,12-13H2,(H2,21,22,25);/q;+1/p-1 |
| InChIKey | XSOYBHHOPWWSNG-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|