C22H31KN4O3S — CID 155658633
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1-methylazetidin-3-yl)piperidin-4-yl]sulfonylazanide (PubChem CID 155658633) has the molecular formula C22H31KN4O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1-methylazetidin-3-yl)piperidin-4-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1-methylazetidin-3-yl)piperidin-4-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658633 |
| Molecular Formula | C22H31KN4O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1-methylazetidin-3-yl)piperidin-4-yl]sulfonylazanide |
| SMILES | CN1CC(N2CCC(S(=O)(=O)[N-]C(=O)Nc3c4c(cc5c3CCC5)CCC4)CC2)C1.[K+] |
| InChI | InChI=1S/C22H32N4O3S.K/c1-25-13-17(14-25)26-10-8-18(9-11-26)30(28,29)24-22(27)23-21-19-6-2-4-15(19)12-16-5-3-7-20(16)21;/h12,17-18H,2-11,13-14H2,1H3,(H2,23,24,27);/q;+1/p-1 |
| InChIKey | USYJEXDQOPNLQY-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |