C23H27KN4O4S — CID 155658516
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-[(1-methyl-6-oxo-3-pyridinyl)methyl]azetidin-3-yl]sulfonylazanide (PubChem CID 155658516) has the molecular formula C23H27KN4O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-[(1-methyl-6-oxo-3-pyridinyl)methyl]azetidin-3-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-[(1-methyl-6-oxo-3-pyridinyl)methyl]azetidin-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658516 |
| Molecular Formula | C23H27KN4O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-[(1-methyl-6-oxo-3-pyridinyl)methyl]azetidin-3-yl]sulfonylazanide |
| SMILES | Cn1cc(CN2CC(S(=O)(=O)[N-]C(=O)Nc3c4c(cc5c3CCC5)CCC4)C2)ccc1=O.[K+] |
| InChI | InChI=1S/C23H28N4O4S.K/c1-26-11-15(8-9-21(26)28)12-27-13-18(14-27)32(30,31)25-23(29)24-22-19-6-2-4-16(19)10-17-5-3-7-20(17)22;/h8-11,18H,2-7,12-14H2,1H3,(H2,24,25,29);/q;+1/p-1 |
| InChIKey | YYWHLKPXLAZCKG-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |