C21H30KN3O3S — CID 155658501
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-(1-pentan-3-ylazetidin-3-yl)sulfonylazanide (PubChem CID 155658501) has the molecular formula C21H30KN3O3S and a molecular weight of 443.65 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-(1-pentan-3-ylazetidin-3-yl)sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-(1-pentan-3-ylazetidin-3-yl)sulfonylazanide |
|---|---|
| PubChem CID | 155658501 |
| Molecular Formula | C21H30KN3O3S |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-(1-pentan-3-ylazetidin-3-yl)sulfonylazanide |
| SMILES | CCC(CC)N1CC(S(=O)(=O)[N-]C(=O)Nc2c3c(cc4c2CCC4)CCC3)C1.[K+] |
| InChI | InChI=1S/C21H31N3O3S.K/c1-3-16(4-2)24-12-17(13-24)28(26,27)23-21(25)22-20-18-9-5-7-14(18)11-15-8-6-10-19(15)20;/h11,16-17H,3-10,12-13H2,1-2H3,(H2,22,23,25);/q;+1/p-1 |
| InChIKey | UYPNNYMKDXNKTK-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |