C21H28KN3O3S — CID 155658566
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(3-methylcyclobutyl)azetidin-3-yl]sulfonylazanide (PubChem CID 155658566) has the molecular formula C21H28KN3O3S and a molecular weight of 441.64 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(3-methylcyclobutyl)azetidin-3-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(3-methylcyclobutyl)azetidin-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658566 |
| Molecular Formula | C21H28KN3O3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(3-methylcyclobutyl)azetidin-3-yl]sulfonylazanide |
| SMILES | CC1CC(N2CC(S(=O)(=O)[N-]C(=O)Nc3c4c(cc5c3CCC5)CCC4)C2)C1.[K+] |
| InChI | InChI=1S/C21H29N3O3S.K/c1-13-8-16(9-13)24-11-17(12-24)28(26,27)23-21(25)22-20-18-6-2-4-14(18)10-15-5-3-7-19(15)20;/h10,13,16-17H,2-9,11-12H2,1H3,(H2,22,23,25);/q;+1/p-1 |
| InChIKey | INNOYNQVUMHAIQ-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |