C19H21F3KN3O4S — CID 155658618
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(2,2,2-trifluoroacetyl)pyrrolidin-3-yl]sulfonylazanide (PubChem CID 155658618) has the molecular formula C19H21F3KN3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(2,2,2-trifluoroacetyl)pyrrolidin-3-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(2,2,2-trifluoroacetyl)pyrrolidin-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658618 |
| Molecular Formula | C19H21F3KN3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(2,2,2-trifluoroacetyl)pyrrolidin-3-yl]sulfonylazanide |
| SMILES | O=C([N-]S(=O)(=O)C1CCN(C(=O)C(F)(F)F)C1)Nc1c2c(cc3c1CCC3)CCC2.[K+] |
| InChI | InChI=1S/C19H22F3N3O4S.K/c20-19(21,22)17(26)25-8-7-13(10-25)30(28,29)24-18(27)23-16-14-5-1-3-11(14)9-12-4-2-6-15(12)16;/h9,13H,1-8,10H2,(H2,23,24,27);/q;+1/p-1 |
| InChIKey | XENQVGUMYGJUCI-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |