C20H26KN3O4S — CID 155658585
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxetan-3-ylmethyl)azetidin-3-yl]sulfonylazanide (PubChem CID 155658585) has the molecular formula C20H26KN3O4S and a molecular weight of 443.61 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxetan-3-ylmethyl)azetidin-3-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxetan-3-ylmethyl)azetidin-3-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658585 |
| Molecular Formula | C20H26KN3O4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(oxetan-3-ylmethyl)azetidin-3-yl]sulfonylazanide |
| SMILES | O=C([N-]S(=O)(=O)C1CN(CC2COC2)C1)Nc1c2c(cc3c1CCC3)CCC2.[K+] |
| InChI | InChI=1S/C20H27N3O4S.K/c24-20(22-28(25,26)16-9-23(10-16)8-13-11-27-12-13)21-19-17-5-1-3-14(17)7-15-4-2-6-18(15)19;/h7,13,16H,1-6,8-12H2,(H2,21,22,24);/q;+1/p-1 |
| InChIKey | ALBBYFAMACTWCE-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |