C20H26KN3O4S — CID 155658593
potassium (1-acetylpiperidin-3-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide (PubChem CID 155658593) has the molecular formula C20H26KN3O4S and a molecular weight of 443.61 g/mol. Its IUPAC name is potassium (1-acetylpiperidin-3-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide.
| Compound Name | potassium (1-acetylpiperidin-3-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide |
|---|---|
| PubChem CID | 155658593 |
| Molecular Formula | C20H26KN3O4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | potassium (1-acetylpiperidin-3-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide |
| SMILES | CC(=O)N1CCCC(S(=O)(=O)[N-]C(=O)Nc2c3c(cc4c2CCC4)CCC3)C1.[K+] |
| InChI | InChI=1S/C20H27N3O4S.K/c1-13(24)23-10-4-7-16(12-23)28(26,27)22-20(25)21-19-17-8-2-5-14(17)11-15-6-3-9-18(15)19;/h11,16H,2-10,12H2,1H3,(H2,21,22,25);/q;+1/p-1 |
| InChIKey | BDWCXAZHPDOCAT-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |