C20H28KN3O3S — CID 155658509
potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1,1,2,2,2-pentadeuterioethyl)piperidin-4-yl]sulfonylazanide (PubChem CID 155658509) has the molecular formula C20H28KN3O3S and a molecular weight of 434.66 g/mol. Its IUPAC name is potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1,1,2,2,2-pentadeuterioethyl)piperidin-4-yl]sulfonylazanide.
| Compound Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1,1,2,2,2-pentadeuterioethyl)piperidin-4-yl]sulfonylazanide |
|---|---|
| PubChem CID | 155658509 |
| Molecular Formula | C20H28KN3O3S |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | potassium 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl-[1-(1,1,2,2,2-pentadeuterioethyl)piperidin-4-yl]sulfonylazanide |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCC(S(=O)(=O)[N-]C(=O)Nc2c3c(cc4c2CCC4)CCC3)CC1.[K+] |
| InChI | InChI=1S/C20H29N3O3S.K/c1-2-23-11-9-16(10-12-23)27(25,26)22-20(24)21-19-17-7-3-5-14(17)13-15-6-4-8-18(15)19;/h13,16H,2-12H2,1H3,(H2,21,22,24);/q;+1/p-1/i1D3,2D2; |
| InChIKey | MKLRQXHTYFRPSC-LUIAAVAXSA-M |
| XLogP | 0.39 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |