C20H27KN3O4S — CID 175724097
CID 175724097 (PubChem CID 175724097) has the molecular formula C20H27KN3O4S and a molecular weight of 444.62 g/mol.
| Compound Name | CID 175724097 |
|---|---|
| PubChem CID | 175724097 |
| Molecular Formula | C20H27KN3O4S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | — |
| SMILES | CC(=O)N1CCCC(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)C1.[K] |
| InChI | InChI=1S/C20H27N3O4S.K/c1-13(24)23-10-4-7-16(12-23)28(26,27)22-20(25)21-19-17-8-2-5-14(17)11-15-6-3-9-18(15)19;/h11,16H,2-10,12H2,1H3,(H2,21,22,25); |
| InChIKey | VOLNHQXYPPLKCT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |