C23H37N3O3S — CID 142529580
1-[3-(dipropylamino)-2-methylpropyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142529580) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is 1-[3-(dipropylamino)-2-methylpropyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[3-(dipropylamino)-2-methylpropyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142529580 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-[3-(dipropylamino)-2-methylpropyl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CCCN(CCC)CC(C)CS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C23H37N3O3S/c1-4-12-26(13-5-2)15-17(3)16-30(28,29)25-23(27)24-22-20-10-6-8-18(20)14-19-9-7-11-21(19)22/h14,17H,4-13,15-16H2,1-3H3,(H2,24,25,27) |
| InChIKey | WYBOZSLFOOLHDR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |